C8H15N — CID 144815707
(1Z,3Z)-5-methylhepta-1,3-dien-1-amine (PubChem CID 144815707) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is (1Z,3Z)-5-methylhepta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-5-methylhepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144815707 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (1Z,3Z)-5-methylhepta-1,3-dien-1-amine |
| SMILES | CCC(C)/C=C\C=C/N |
| InChI | InChI=1S/C8H15N/c1-3-8(2)6-4-5-7-9/h4-8H,3,9H2,1-2H3/b6-4-,7-5- |
| InChIKey | ZFTPTMHDEZKRER-PEPZGXQESA-N |
| XLogP | 2.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|