C13H25N — CID 88882583
2-butan-2-yl-6-methylocta-2,4-dien-1-amine (PubChem CID 88882583) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 2-butan-2-yl-6-methylocta-2,4-dien-1-amine.
| Compound Name | 2-butan-2-yl-6-methylocta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 88882583 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 2-butan-2-yl-6-methylocta-2,4-dien-1-amine |
| SMILES | CCC(C)C=CC=C(CN)C(C)CC |
| InChI | InChI=1S/C13H25N/c1-5-11(3)8-7-9-13(10-14)12(4)6-2/h7-9,11-12H,5-6,10,14H2,1-4H3 |
| InChIKey | XYTQYOXJKANYGM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|