C14H22 — CID 123413794
4-ethenyl-3,8-dimethyldeca-2,4,6-triene (PubChem CID 123413794) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 4-ethenyl-3,8-dimethyldeca-2,4,6-triene.
| Compound Name | 4-ethenyl-3,8-dimethyldeca-2,4,6-triene |
|---|---|
| PubChem CID | 123413794 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 4-ethenyl-3,8-dimethyldeca-2,4,6-triene |
| SMILES | C=CC(=CC=CC(C)CC)C(C)=CC |
| InChI | InChI=1S/C14H22/c1-6-12(4)10-9-11-14(8-3)13(5)7-2/h7-12H,3,6H2,1-2,4-5H3 |
| InChIKey | UHFYWVKWGXZAOA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|