C12H24 — CID 145319399
(Z)-3,5-dimethyl-4-methylidenehex-2-ene;propane (PubChem CID 145319399) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is (Z)-3,5-dimethyl-4-methylidenehex-2-ene;propane.
| Compound Name | (Z)-3,5-dimethyl-4-methylidenehex-2-ene;propane |
|---|---|
| PubChem CID | 145319399 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | (Z)-3,5-dimethyl-4-methylidenehex-2-ene;propane |
| SMILES | C=C(/C(C)=C\C)C(C)C.CCC |
| InChI | InChI=1S/C9H16.C3H8/c1-6-8(4)9(5)7(2)3;1-3-2/h6-7H,5H2,1-4H3;3H2,1-2H3/b8-6-; |
| InChIKey | SMLQZVKBXIJILG-PHZXCRFESA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|