C10H19N — CID 123516073
N,N,2,4-tetramethyl-3-methylidenepent-1-en-1-amine (PubChem CID 123516073) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is N,N,2,4-tetramethyl-3-methylidenepent-1-en-1-amine.
| Compound Name | N,N,2,4-tetramethyl-3-methylidenepent-1-en-1-amine |
|---|---|
| PubChem CID | 123516073 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | N,N,2,4-tetramethyl-3-methylidenepent-1-en-1-amine |
| SMILES | C=C(C(C)=CN(C)C)C(C)C |
| InChI | InChI=1S/C10H19N/c1-8(2)10(4)9(3)7-11(5)6/h7-8H,4H2,1-3,5-6H3 |
| InChIKey | SQLOQGFUXUKZRI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|