C9H15W — CID 155744599
[(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten (PubChem CID 155744599) has the molecular formula C9H15W and a molecular weight of 307.06 g/mol. Its IUPAC name is [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten.
| Compound Name | [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten |
|---|---|
| PubChem CID | 155744599 |
| Molecular Formula | C9H15W |
| Molecular Weight | 307.06 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten |
| SMILES | [H]/[W]=C/C=C(/C)C(=C)C(C)C |
| InChI | InChI=1S/C9H14.W.H/c1-6-8(4)9(5)7(2)3;;/h1,6-7H,5H2,2-4H3;;/b8-6-;; |
| InChIKey | PZWWGTLBFIOBPT-OTDBEEGXSA-N |
| XLogP | 2.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.06 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|