About [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten
[(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten (PubChem CID 155744599) has the molecular formula C9H15W
and a molecular weight of 307.06 g/mol. Its IUPAC name is [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten.
Molecular Properties
| Compound Name | [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten |
| PubChem CID | 155744599 |
| Molecular Formula | C9H15W |
| Molecular Weight | 307.06 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten |
| SMILES | [H]/[W]=C/C=C(/C)C(=C)C(C)C |
| InChI | InChI=1S/C9H14.W.H/c1-6-8(4)9(5)7(2)3;;/h1,6-7H,5H2,2-4H3;;/b8-6-;; |
| InChIKey | PZWWGTLBFIOBPT-OTDBEEGXSA-N |
| XLogP | 2.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.06 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten?
The IUPAC name of [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten (CID 155744599) is [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten.
What is the SMILES notation for [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten?
The canonical SMILES for [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten is [H]/[W]=C/C=C(/C)C(=C)C(C)C.
What is the InChIKey of [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten?
The InChIKey is PZWWGTLBFIOBPT-OTDBEEGXSA-N. The full InChI is InChI=1S/C9H14.W.H/c1-6-8(4)9(5)7(2)3;;/h1,6-7H,5H2,2-4H3;;/b8-6-;;.
What are the key properties of [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten?
[(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten has a molecular weight of 307.06 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3,5-dimethyl-4-methylidenehex-2-enylidene]-hydridotungsten is sourced from PubChem (CID 155744599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).