C12H20 — CID 143963935
(3Z)-6-methyl-5-methylidene-4-propan-2-ylhepta-1,3-diene (PubChem CID 143963935) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (3Z)-6-methyl-5-methylidene-4-propan-2-ylhepta-1,3-diene.
| Compound Name | (3Z)-6-methyl-5-methylidene-4-propan-2-ylhepta-1,3-diene |
|---|---|
| PubChem CID | 143963935 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (3Z)-6-methyl-5-methylidene-4-propan-2-ylhepta-1,3-diene |
| SMILES | C=C/C=C(\C(=C)C(C)C)C(C)C |
| InChI | InChI=1S/C12H20/c1-7-8-12(10(4)5)11(6)9(2)3/h7-10H,1,6H2,2-5H3/b12-8- |
| InChIKey | HVUSNSCTHAVCFV-WQLSENKSSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|