C10H16 — CID 123577070
2-methyl-3-propan-2-ylhexa-1,3,5-triene (PubChem CID 123577070) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is 2-methyl-3-propan-2-ylhexa-1,3,5-triene.
| Compound Name | 2-methyl-3-propan-2-ylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 123577070 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 2-methyl-3-propan-2-ylhexa-1,3,5-triene |
| SMILES | C=CC=C(C(=C)C)C(C)C |
| InChI | InChI=1S/C10H16/c1-6-7-10(8(2)3)9(4)5/h6-7,9H,1-2H2,3-5H3 |
| InChIKey | RZUBFFPRXVPUGX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|