C13H28O — CID 144511153
ethane;(3E)-2-methylhexa-1,3,5-trien-3-ol (PubChem CID 144511153) has the molecular formula C13H28O and a molecular weight of 200.37 g/mol. Its IUPAC name is ethane;(3E)-2-methylhexa-1,3,5-trien-3-ol.
| Compound Name | ethane;(3E)-2-methylhexa-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 144511153 |
| Molecular Formula | C13H28O |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.21 |
| IUPAC Name | ethane;(3E)-2-methylhexa-1,3,5-trien-3-ol |
| SMILES | C=C/C=C(/O)C(=C)C.CC.CC.CC |
| InChI | InChI=1S/C7H10O.3C2H6/c1-4-5-7(8)6(2)3;3*1-2/h4-5,8H,1-2H2,3H3;3*1-2H3/b7-5+;;; |
| InChIKey | YIEBMIAUJVVODR-OACAQMFHSA-N |
| XLogP | 5.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|