C10H15NO — CID 143409642
N-methyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]acetamide (PubChem CID 143409642) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-methyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]acetamide.
| Compound Name | N-methyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]acetamide |
|---|---|
| PubChem CID | 143409642 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-methyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]acetamide |
| SMILES | C=C/C=C(\C(=C)C)N(C)C(C)=O |
| InChI | InChI=1S/C10H15NO/c1-6-7-10(8(2)3)11(5)9(4)12/h6-7H,1-2H2,3-5H3/b10-7+ |
| InChIKey | ISPYAIBKYNZCLA-JXMROGBWSA-N |
| XLogP | 2.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|