C9H13NO — CID 142965256
N-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)acetamide (PubChem CID 142965256) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is N-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)acetamide.
| Compound Name | N-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)acetamide |
|---|---|
| PubChem CID | 142965256 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | N-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)acetamide |
| SMILES | C=CC(=C)C(=C)N(C)C(C)=O |
| InChI | InChI=1S/C9H13NO/c1-6-7(2)8(3)10(5)9(4)11/h6H,1-3H2,4-5H3 |
| InChIKey | HUGMTWVQSJTWLO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|