C8H9FO — CID 142839788
(3Z)-3-(1-fluoroethenyl)hexa-3,5-dien-2-one (PubChem CID 142839788) has the molecular formula C8H9FO and a molecular weight of 140.16 g/mol. Its IUPAC name is (3Z)-3-(1-fluoroethenyl)hexa-3,5-dien-2-one.
| Compound Name | (3Z)-3-(1-fluoroethenyl)hexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 142839788 |
| Molecular Formula | C8H9FO |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | (3Z)-3-(1-fluoroethenyl)hexa-3,5-dien-2-one |
| SMILES | C=C/C=C(\C(=C)F)C(C)=O |
| InChI | InChI=1S/C8H9FO/c1-4-5-8(6(2)9)7(3)10/h4-5H,1-2H2,3H3/b8-5+ |
| InChIKey | ZYWPZGJRPHDRKG-VMPITWQZSA-N |
| XLogP | 2.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|