C10H17BO3 — CID 162724442
ethane;[(3Z)-5-methylidene-6-oxohepta-1,3-dien-4-yl]boronic acid (PubChem CID 162724442) has the molecular formula C10H17BO3 and a molecular weight of 196.05 g/mol. Its IUPAC name is ethane;[(3Z)-5-methylidene-6-oxohepta-1,3-dien-4-yl]boronic acid.
| Compound Name | ethane;[(3Z)-5-methylidene-6-oxohepta-1,3-dien-4-yl]boronic acid |
|---|---|
| PubChem CID | 162724442 |
| Molecular Formula | C10H17BO3 |
| Molecular Weight | 196.05 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | ethane;[(3Z)-5-methylidene-6-oxohepta-1,3-dien-4-yl]boronic acid |
| SMILES | C=C/C=C(/B(O)O)C(=C)C(C)=O.CC |
| InChI | InChI=1S/C8H11BO3.C2H6/c1-4-5-8(9(11)12)6(2)7(3)10;1-2/h4-5,11-12H,1-2H2,3H3;1-2H3/b8-5+; |
| InChIKey | OJGZAEWYXDWZHG-HAAWTFQLSA-N |
| XLogP | 1.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.05 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|