C7H8BNO2 — CID 144587711
[(3Z)-2-cyanohexa-1,3,5-trien-3-yl]boronic acid (PubChem CID 144587711) has the molecular formula C7H8BNO2 and a molecular weight of 148.96 g/mol. Its IUPAC name is [(3Z)-2-cyanohexa-1,3,5-trien-3-yl]boronic acid.
| Compound Name | [(3Z)-2-cyanohexa-1,3,5-trien-3-yl]boronic acid |
|---|---|
| PubChem CID | 144587711 |
| Molecular Formula | C7H8BNO2 |
| Molecular Weight | 148.96 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | [(3Z)-2-cyanohexa-1,3,5-trien-3-yl]boronic acid |
| SMILES | C=C/C=C(/B(O)O)C(=C)C#N |
| InChI | InChI=1S/C7H8BNO2/c1-3-4-7(8(10)11)6(2)5-9/h3-4,10-11H,1-2H2/b7-4+ |
| InChIKey | LHBJYAONEMUNEU-QPJJXVBHSA-N |
| XLogP | 0.19 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.96 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|