C9H5N3 — CID 144961491
(3Z)-hexa-1,3,5-triene-1,2,3-tricarbonitrile (PubChem CID 144961491) has the molecular formula C9H5N3 and a molecular weight of 155.16 g/mol. Its IUPAC name is (3Z)-hexa-1,3,5-triene-1,2,3-tricarbonitrile.
| Compound Name | (3Z)-hexa-1,3,5-triene-1,2,3-tricarbonitrile |
|---|---|
| PubChem CID | 144961491 |
| Molecular Formula | C9H5N3 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | (3Z)-hexa-1,3,5-triene-1,2,3-tricarbonitrile |
| SMILES | C=C/C(C#N)=C(/C#N)C(=C)C#N |
| InChI | InChI=1S/C9H5N3/c1-3-8(5-11)9(6-12)7(2)4-10/h3H,1-2H2/b9-8+ |
| InChIKey | ZKKYEGWEWHUGMH-CMDGGOBGSA-N |
| XLogP | 1.60 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|