C8H10N2O — CID 166130684
(3Z)-4-amino-3-methoxy-2-methylidenehexa-3,5-dienenitrile (PubChem CID 166130684) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is (3Z)-4-amino-3-methoxy-2-methylidenehexa-3,5-dienenitrile.
| Compound Name | (3Z)-4-amino-3-methoxy-2-methylidenehexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 166130684 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (3Z)-4-amino-3-methoxy-2-methylidenehexa-3,5-dienenitrile |
| SMILES | C=C/C(N)=C(/OC)C(=C)C#N |
| InChI | InChI=1S/C8H10N2O/c1-4-7(10)8(11-3)6(2)5-9/h4H,1-2,10H2,3H3/b8-7- |
| InChIKey | WADWDRIIIFQEAY-FPLPWBNLSA-N |
| XLogP | 1.07 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|