About methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile
methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile (PubChem CID 159336201) has the molecular formula C10H14N2O3
and a molecular weight of 210.23 g/mol. Its IUPAC name is methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile.
Molecular Properties
| Compound Name | methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile |
| PubChem CID | 159336201 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile |
| SMILES | C=CC#N.C=CC(=O)OC.C=CC(N)=O |
| InChI | InChI=1S/C4H6O2.C3H5NO.C3H3N/c1-3-4(5)6-2;1-2-3(4)5;1-2-3-4/h3H,1H2,2H3;2H,1H2,(H2,4,5);2H,1H2 |
| InChIKey | LFOJZJZXZDRKTC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile?
The IUPAC name of methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile (CID 159336201) is methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile.
What is the SMILES notation for methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile?
The canonical SMILES for methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile is C=CC#N.C=CC(=O)OC.C=CC(N)=O.
What is the InChIKey of methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile?
The InChIKey is LFOJZJZXZDRKTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C3H5NO.C3H3N/c1-3-4(5)6-2;1-2-3(4)5;1-2-3-4/h3H,1H2,2H3;2H,1H2,(H2,4,5);2H,1H2.
What are the key properties of methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile?
methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile has a molecular weight of 210.23 g/mol, XLogP of 0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl prop-2-enoate;prop-2-enamide;prop-2-enenitrile is sourced from PubChem (CID 159336201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).