C7H10BrNO — CID 166130604
(3Z)-4-bromo-3-methoxyhexa-1,3,5-trien-2-amine (PubChem CID 166130604) has the molecular formula C7H10BrNO and a molecular weight of 204.07 g/mol. Its IUPAC name is (3Z)-4-bromo-3-methoxyhexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-4-bromo-3-methoxyhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 166130604 |
| Molecular Formula | C7H10BrNO |
| Molecular Weight | 204.07 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | (3Z)-4-bromo-3-methoxyhexa-1,3,5-trien-2-amine |
| SMILES | C=C/C(Br)=C(/OC)C(=C)N |
| InChI | InChI=1S/C7H10BrNO/c1-4-6(8)7(10-3)5(2)9/h4H,1-2,9H2,3H3/b7-6- |
| InChIKey | QTGSVMWRICQNMU-SREVYHEPSA-N |
| XLogP | 1.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.07 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|