C8H8FN — CID 143717901
(2Z,4Z)-2-ethenyl-3-fluorohexa-2,4-dienenitrile (PubChem CID 143717901) has the molecular formula C8H8FN and a molecular weight of 137.16 g/mol. Its IUPAC name is (2Z,4Z)-2-ethenyl-3-fluorohexa-2,4-dienenitrile.
| Compound Name | (2Z,4Z)-2-ethenyl-3-fluorohexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 143717901 |
| Molecular Formula | C8H8FN |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | (2Z,4Z)-2-ethenyl-3-fluorohexa-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C(F)\C=C/C |
| InChI | InChI=1S/C8H8FN/c1-3-5-8(9)7(4-2)6-10/h3-5H,2H2,1H3/b5-3-,8-7- |
| InChIKey | AYWNNZVUSXYCPX-OVRZELKPSA-N |
| XLogP | 2.50 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|