C10H15FN2 — CID 138699183
(2Z,4Z)-2-ethenyl-N-[(Z)-ethylideneamino]-3-fluorohexa-2,4-dien-1-amine (PubChem CID 138699183) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is (2Z,4Z)-2-ethenyl-N-[(Z)-ethylideneamino]-3-fluorohexa-2,4-dien-1-amine.
| Compound Name | (2Z,4Z)-2-ethenyl-N-[(Z)-ethylideneamino]-3-fluorohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 138699183 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | (2Z,4Z)-2-ethenyl-N-[(Z)-ethylideneamino]-3-fluorohexa-2,4-dien-1-amine |
| SMILES | C=C/C(CN/N=C\C)=C(F)\C=C/C |
| InChI | InChI=1S/C10H15FN2/c1-4-7-10(11)9(5-2)8-13-12-6-3/h4-7,13H,2,8H2,1,3H3/b7-4-,10-9-,12-6- |
| InChIKey | JOTOOBKQPNYYPQ-SUHDSNEJSA-N |
| XLogP | 2.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|