About 2-cyanoprop-2-enoate;prop-2-enal
2-cyanoprop-2-enoate;prop-2-enal (PubChem CID 19379505) has the molecular formula C7H6NO3-
and a molecular weight of 152.13 g/mol. Its IUPAC name is 2-cyanoprop-2-enoate;prop-2-enal.
Molecular Properties
| Compound Name | 2-cyanoprop-2-enoate;prop-2-enal |
| PubChem CID | 19379505 |
| Molecular Formula | C7H6NO3- |
| Molecular Weight | 152.13 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 2-cyanoprop-2-enoate;prop-2-enal |
| SMILES | C=C(C#N)C(=O)[O-].C=CC=O |
| InChI | InChI=1S/C4H3NO2.C3H4O/c1-3(2-5)4(6)7;1-2-3-4/h1H2,(H,6,7);2-3H,1H2/p-1 |
| InChIKey | IPZOXFMDRGPWDQ-UHFFFAOYSA-M |
| XLogP | -0.81 |
| TPSA | 80.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.13 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoprop-2-enoate;prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoprop-2-enoate;prop-2-enal?
The IUPAC name of 2-cyanoprop-2-enoate;prop-2-enal (CID 19379505) is 2-cyanoprop-2-enoate;prop-2-enal.
What is the SMILES notation for 2-cyanoprop-2-enoate;prop-2-enal?
The canonical SMILES for 2-cyanoprop-2-enoate;prop-2-enal is C=C(C#N)C(=O)[O-].C=CC=O.
What is the InChIKey of 2-cyanoprop-2-enoate;prop-2-enal?
The InChIKey is IPZOXFMDRGPWDQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H3NO2.C3H4O/c1-3(2-5)4(6)7;1-2-3-4/h1H2,(H,6,7);2-3H,1H2/p-1.
What are the key properties of 2-cyanoprop-2-enoate;prop-2-enal?
2-cyanoprop-2-enoate;prop-2-enal has a molecular weight of 152.13 g/mol, XLogP of -0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoprop-2-enoate;prop-2-enal is sourced from PubChem (CID 19379505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).