About acetonitrile;propan-2-one;prop-2-enal
acetonitrile;propan-2-one;prop-2-enal (PubChem CID 87702978) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is acetonitrile;propan-2-one;prop-2-enal.
Molecular Properties
| Compound Name | acetonitrile;propan-2-one;prop-2-enal |
| PubChem CID | 87702978 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | acetonitrile;propan-2-one;prop-2-enal |
| SMILES | C=CC=O.CC#N.CC(C)=O |
| InChI | InChI=1S/C3H6O.C3H4O.C2H3N/c1-3(2)4;1-2-3-4;1-2-3/h1-2H3;2-3H,1H2;1H3 |
| InChIKey | QPJQCAUTDKSUSR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;propan-2-one;prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;propan-2-one;prop-2-enal?
The IUPAC name of acetonitrile;propan-2-one;prop-2-enal (CID 87702978) is acetonitrile;propan-2-one;prop-2-enal.
What is the SMILES notation for acetonitrile;propan-2-one;prop-2-enal?
The canonical SMILES for acetonitrile;propan-2-one;prop-2-enal is C=CC=O.CC#N.CC(C)=O.
What is the InChIKey of acetonitrile;propan-2-one;prop-2-enal?
The InChIKey is QPJQCAUTDKSUSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C3H4O.C2H3N/c1-3(2)4;1-2-3-4;1-2-3/h1-2H3;2-3H,1H2;1H3.
What are the key properties of acetonitrile;propan-2-one;prop-2-enal?
acetonitrile;propan-2-one;prop-2-enal has a molecular weight of 155.20 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;propan-2-one;prop-2-enal is sourced from PubChem (CID 87702978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).