About acetonitrile;butan-2-one;propan-2-one
acetonitrile;butan-2-one;propan-2-one (PubChem CID 165107970) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is acetonitrile;butan-2-one;propan-2-one.
Molecular Properties
| Compound Name | acetonitrile;butan-2-one;propan-2-one |
| PubChem CID | 165107970 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | acetonitrile;butan-2-one;propan-2-one |
| SMILES | CC#N.CC(C)=O.CCC(C)=O |
| InChI | InChI=1S/C4H8O.C3H6O.C2H3N/c1-3-4(2)5;1-3(2)4;1-2-3/h3H2,1-2H3;1-2H3;1H3 |
| InChIKey | ZLUJTYWSEAOYPM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetonitrile;butan-2-one;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;butan-2-one;propan-2-one?
The IUPAC name of acetonitrile;butan-2-one;propan-2-one (CID 165107970) is acetonitrile;butan-2-one;propan-2-one.
What is the SMILES notation for acetonitrile;butan-2-one;propan-2-one?
The canonical SMILES for acetonitrile;butan-2-one;propan-2-one is CC#N.CC(C)=O.CCC(C)=O.
What is the InChIKey of acetonitrile;butan-2-one;propan-2-one?
The InChIKey is ZLUJTYWSEAOYPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C3H6O.C2H3N/c1-3-4(2)5;1-3(2)4;1-2-3/h3H2,1-2H3;1-2H3;1H3.
What are the key properties of acetonitrile;butan-2-one;propan-2-one?
acetonitrile;butan-2-one;propan-2-one has a molecular weight of 171.24 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;butan-2-one;propan-2-one is sourced from PubChem (CID 165107970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).