About ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile
ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile (PubChem CID 161344274) has the molecular formula C11H15NO3
and a molecular weight of 209.24 g/mol. Its IUPAC name is ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile.
Molecular Properties
| Compound Name | ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile |
| PubChem CID | 161344274 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile |
| SMILES | C=CC#N.C=CC(=O)OCC.C=CC=O |
| InChI | InChI=1S/C5H8O2.C3H3N.C3H4O/c1-3-5(6)7-4-2;2*1-2-3-4/h3H,1,4H2,2H3;2H,1H2;2-3H,1H2 |
| InChIKey | VNBZBKXXRNAOJV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile?
The IUPAC name of ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile (CID 161344274) is ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile.
What is the SMILES notation for ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile?
The canonical SMILES for ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile is C=CC#N.C=CC(=O)OCC.C=CC=O.
What is the InChIKey of ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile?
The InChIKey is VNBZBKXXRNAOJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C3H3N.C3H4O/c1-3-5(6)7-4-2;2*1-2-3-4/h3H,1,4H2,2H3;2H,1H2;2-3H,1H2.
What are the key properties of ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile?
ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile has a molecular weight of 209.24 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl prop-2-enoate;prop-2-enal;prop-2-enenitrile is sourced from PubChem (CID 161344274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).