C12H16N2O6 — CID 86733830
butane-1,4-diol;bis(2-cyanoprop-2-enoic acid) (PubChem CID 86733830) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is butane-1,4-diol;bis(2-cyanoprop-2-enoic acid).
| Compound Name | butane-1,4-diol;bis(2-cyanoprop-2-enoic acid) |
|---|---|
| PubChem CID | 86733830 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | butane-1,4-diol;bis(2-cyanoprop-2-enoic acid) |
| SMILES | C=C(C#N)C(=O)O.C=C(C#N)C(=O)O.OCCCCO |
| InChI | InChI=1S/2C4H3NO2.C4H10O2/c2*1-3(2-5)4(6)7;5-3-1-2-4-6/h2*1H2,(H,6,7);5-6H,1-4H2 |
| InChIKey | MOJFQWXLEWTWTI-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 162.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|