About 2-cyanoprop-2-enoic acid;3-methylheptane
2-cyanoprop-2-enoic acid;3-methylheptane (PubChem CID 174799306) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is 2-cyanoprop-2-enoic acid;3-methylheptane.
Molecular Properties
| Compound Name | 2-cyanoprop-2-enoic acid;3-methylheptane |
| PubChem CID | 174799306 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-cyanoprop-2-enoic acid;3-methylheptane |
| SMILES | C=C(C#N)C(=O)O.CCCCC(C)CC |
| InChI | InChI=1S/C8H18.C4H3NO2/c1-4-6-7-8(3)5-2;1-3(2-5)4(6)7/h8H,4-7H2,1-3H3;1H2,(H,6,7) |
| InChIKey | DFTOHSLYWYLADC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoprop-2-enoic acid;3-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoprop-2-enoic acid;3-methylheptane?
The IUPAC name of 2-cyanoprop-2-enoic acid;3-methylheptane (CID 174799306) is 2-cyanoprop-2-enoic acid;3-methylheptane.
What is the SMILES notation for 2-cyanoprop-2-enoic acid;3-methylheptane?
The canonical SMILES for 2-cyanoprop-2-enoic acid;3-methylheptane is C=C(C#N)C(=O)O.CCCCC(C)CC.
What is the InChIKey of 2-cyanoprop-2-enoic acid;3-methylheptane?
The InChIKey is DFTOHSLYWYLADC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C4H3NO2/c1-4-6-7-8(3)5-2;1-3(2-5)4(6)7/h8H,4-7H2,1-3H3;1H2,(H,6,7).
What are the key properties of 2-cyanoprop-2-enoic acid;3-methylheptane?
2-cyanoprop-2-enoic acid;3-methylheptane has a molecular weight of 211.30 g/mol, XLogP of 3.37, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoprop-2-enoic acid;3-methylheptane is sourced from PubChem (CID 174799306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).