About 2-cyanoprop-2-enoic acid;hexan-2-ol
2-cyanoprop-2-enoic acid;hexan-2-ol (PubChem CID 175333781) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-cyanoprop-2-enoic acid;hexan-2-ol.
Molecular Properties
| Compound Name | 2-cyanoprop-2-enoic acid;hexan-2-ol |
| PubChem CID | 175333781 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2-cyanoprop-2-enoic acid;hexan-2-ol |
| SMILES | C=C(C#N)C(=O)O.CCCCC(C)O |
| InChI | InChI=1S/C6H14O.C4H3NO2/c1-3-4-5-6(2)7;1-3(2-5)4(6)7/h6-7H,3-5H2,1-2H3;1H2,(H,6,7) |
| InChIKey | IGVRSDSYVKELDP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoprop-2-enoic acid;hexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoprop-2-enoic acid;hexan-2-ol?
The IUPAC name of 2-cyanoprop-2-enoic acid;hexan-2-ol (CID 175333781) is 2-cyanoprop-2-enoic acid;hexan-2-ol.
What is the SMILES notation for 2-cyanoprop-2-enoic acid;hexan-2-ol?
The canonical SMILES for 2-cyanoprop-2-enoic acid;hexan-2-ol is C=C(C#N)C(=O)O.CCCCC(C)O.
What is the InChIKey of 2-cyanoprop-2-enoic acid;hexan-2-ol?
The InChIKey is IGVRSDSYVKELDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C4H3NO2/c1-3-4-5-6(2)7;1-3(2-5)4(6)7/h6-7H,3-5H2,1-2H3;1H2,(H,6,7).
What are the key properties of 2-cyanoprop-2-enoic acid;hexan-2-ol?
2-cyanoprop-2-enoic acid;hexan-2-ol has a molecular weight of 199.25 g/mol, XLogP of 1.71, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoprop-2-enoic acid;hexan-2-ol is sourced from PubChem (CID 175333781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).