About 2-cyanoprop-2-enoic acid;N-methylmethanamine
2-cyanoprop-2-enoic acid;N-methylmethanamine (PubChem CID 21218802) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 2-cyanoprop-2-enoic acid;N-methylmethanamine.
Molecular Properties
| Compound Name | 2-cyanoprop-2-enoic acid;N-methylmethanamine |
| PubChem CID | 21218802 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 2-cyanoprop-2-enoic acid;N-methylmethanamine |
| SMILES | C=C(C#N)C(=O)O.CNC |
| InChI | InChI=1S/C4H3NO2.C2H7N/c1-3(2-5)4(6)7;1-3-2/h1H2,(H,6,7);3H,1-2H3 |
| InChIKey | ZCKQTDLWNIHBTE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoprop-2-enoic acid;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoprop-2-enoic acid;N-methylmethanamine?
The IUPAC name of 2-cyanoprop-2-enoic acid;N-methylmethanamine (CID 21218802) is 2-cyanoprop-2-enoic acid;N-methylmethanamine.
What is the SMILES notation for 2-cyanoprop-2-enoic acid;N-methylmethanamine?
The canonical SMILES for 2-cyanoprop-2-enoic acid;N-methylmethanamine is C=C(C#N)C(=O)O.CNC.
What is the InChIKey of 2-cyanoprop-2-enoic acid;N-methylmethanamine?
The InChIKey is ZCKQTDLWNIHBTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2.C2H7N/c1-3(2-5)4(6)7;1-3-2/h1H2,(H,6,7);3H,1-2H3.
What are the key properties of 2-cyanoprop-2-enoic acid;N-methylmethanamine?
2-cyanoprop-2-enoic acid;N-methylmethanamine has a molecular weight of 142.16 g/mol, XLogP of -0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoprop-2-enoic acid;N-methylmethanamine is sourced from PubChem (CID 21218802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).