C10H10N2 — CID 145301363
(Z)-2,3-bis(prop-1-en-2-yl)but-2-enedinitrile (PubChem CID 145301363) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is (Z)-2,3-bis(prop-1-en-2-yl)but-2-enedinitrile.
| Compound Name | (Z)-2,3-bis(prop-1-en-2-yl)but-2-enedinitrile |
|---|---|
| PubChem CID | 145301363 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | (Z)-2,3-bis(prop-1-en-2-yl)but-2-enedinitrile |
| SMILES | C=C(C)/C(C#N)=C(/C#N)C(=C)C |
| InChI | InChI=1S/C10H10N2/c1-7(2)9(5-11)10(6-12)8(3)4/h1,3H2,2,4H3/b10-9- |
| InChIKey | UVKXOZSPWBFMJE-KTKRTIGZSA-N |
| XLogP | 2.48 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|