About isocyanic acid;2-methylprop-2-enenitrile
isocyanic acid;2-methylprop-2-enenitrile (PubChem CID 172858040) has the molecular formula C5H6N2O
and a molecular weight of 110.12 g/mol. Its IUPAC name is isocyanic acid;2-methylprop-2-enenitrile.
Molecular Properties
| Compound Name | isocyanic acid;2-methylprop-2-enenitrile |
| PubChem CID | 172858040 |
| Molecular Formula | C5H6N2O |
| Molecular Weight | 110.12 g/mol |
| Exact Mass | 110.05 |
| IUPAC Name | isocyanic acid;2-methylprop-2-enenitrile |
| SMILES | C=C(C)C#N.N=C=O |
| InChI | InChI=1S/C4H5N.CHNO/c1-4(2)3-5;2-1-3/h1H2,2H3;2H |
| InChIKey | YZCBFGCULCGUDY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.12 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanic acid;2-methylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanic acid;2-methylprop-2-enenitrile?
The IUPAC name of isocyanic acid;2-methylprop-2-enenitrile (CID 172858040) is isocyanic acid;2-methylprop-2-enenitrile.
What is the SMILES notation for isocyanic acid;2-methylprop-2-enenitrile?
The canonical SMILES for isocyanic acid;2-methylprop-2-enenitrile is C=C(C)C#N.N=C=O.
What is the InChIKey of isocyanic acid;2-methylprop-2-enenitrile?
The InChIKey is YZCBFGCULCGUDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N.CHNO/c1-4(2)3-5;2-1-3/h1H2,2H3;2H.
What are the key properties of isocyanic acid;2-methylprop-2-enenitrile?
isocyanic acid;2-methylprop-2-enenitrile has a molecular weight of 110.12 g/mol, XLogP of 0.99, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanic acid;2-methylprop-2-enenitrile is sourced from PubChem (CID 172858040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).