About acetic acid;carbonocyanidic acid;hydrate
acetic acid;carbonocyanidic acid;hydrate (PubChem CID 173278847) has the molecular formula C6H11NO7
and a molecular weight of 209.15 g/mol. Its IUPAC name is acetic acid;carbonocyanidic acid;hydrate.
Molecular Properties
| Compound Name | acetic acid;carbonocyanidic acid;hydrate |
| PubChem CID | 173278847 |
| Molecular Formula | C6H11NO7 |
| Molecular Weight | 209.15 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | acetic acid;carbonocyanidic acid;hydrate |
| SMILES | CC(=O)O.CC(=O)O.N#CC(=O)O.O |
| InChI | InChI=1S/C2HNO2.2C2H4O2.H2O/c3-1-2(4)5;2*1-2(3)4;/h(H,4,5);2*1H3,(H,3,4);1H2 |
| InChIKey | NROSZFKAENVEDQ-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 167.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.15 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;carbonocyanidic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;carbonocyanidic acid;hydrate?
The IUPAC name of acetic acid;carbonocyanidic acid;hydrate (CID 173278847) is acetic acid;carbonocyanidic acid;hydrate.
What is the SMILES notation for acetic acid;carbonocyanidic acid;hydrate?
The canonical SMILES for acetic acid;carbonocyanidic acid;hydrate is CC(=O)O.CC(=O)O.N#CC(=O)O.O.
What is the InChIKey of acetic acid;carbonocyanidic acid;hydrate?
The InChIKey is NROSZFKAENVEDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HNO2.2C2H4O2.H2O/c3-1-2(4)5;2*1-2(3)4;/h(H,4,5);2*1H3,(H,3,4);1H2.
What are the key properties of acetic acid;carbonocyanidic acid;hydrate?
acetic acid;carbonocyanidic acid;hydrate has a molecular weight of 209.15 g/mol, XLogP of -1.05, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;carbonocyanidic acid;hydrate is sourced from PubChem (CID 173278847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).