About tripotassium;carbonocyanidic acid;hydride
tripotassium;carbonocyanidic acid;hydride (PubChem CID 173291553) has the molecular formula C2H4K3NO2
and a molecular weight of 191.35 g/mol. Its IUPAC name is tripotassium;carbonocyanidic acid;hydride.
Molecular Properties
| Compound Name | tripotassium;carbonocyanidic acid;hydride |
| PubChem CID | 173291553 |
| Molecular Formula | C2H4K3NO2 |
| Molecular Weight | 191.35 g/mol |
| Exact Mass | 190.92 |
| IUPAC Name | tripotassium;carbonocyanidic acid;hydride |
| SMILES | N#CC(=O)O.[H-].[H-].[H-].[K+].[K+].[K+] |
| InChI | InChI=1S/C2HNO2.3K.3H/c3-1-2(4)5;;;;;;/h(H,4,5);;;;;;/q;3*+1;3*-1 |
| InChIKey | OGRZFMPIUBNZSM-UHFFFAOYSA-N |
| XLogP | -9.06 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.35 |
| LogP ≤ 5 | -9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|
Analyze tripotassium;carbonocyanidic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripotassium;carbonocyanidic acid;hydride?
The IUPAC name of tripotassium;carbonocyanidic acid;hydride (CID 173291553) is tripotassium;carbonocyanidic acid;hydride.
What is the SMILES notation for tripotassium;carbonocyanidic acid;hydride?
The canonical SMILES for tripotassium;carbonocyanidic acid;hydride is N#CC(=O)O.[H-].[H-].[H-].[K+].[K+].[K+].
What is the InChIKey of tripotassium;carbonocyanidic acid;hydride?
The InChIKey is OGRZFMPIUBNZSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HNO2.3K.3H/c3-1-2(4)5;;;;;;/h(H,4,5);;;;;;/q;3*+1;3*-1.
What are the key properties of tripotassium;carbonocyanidic acid;hydride?
tripotassium;carbonocyanidic acid;hydride has a molecular weight of 191.35 g/mol, XLogP of -9.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tripotassium;carbonocyanidic acid;hydride is sourced from PubChem (CID 173291553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).