potassium but-2-ynedioic acid

C4H2KO4+ — CID 18763942

IUPACpotassium but-2-ynedioic acid
SMILESO=C(O)C#CC(=O)O.[K+]
InChIInChI=1S/C4H2O4.K/c5-3(6)1-2-4(7)8;/h(H,5,6)(H,7,8);/q;+1
InChIKeyKLLYWRUTRAFSJT-UHFFFAOYSA-N
MW153.15 g/mol
LogP-3.84
Rot. Bonds

About potassium but-2-ynedioic acid

potassium but-2-ynedioic acid (PubChem CID 18763942) has the molecular formula C4H2KO4+ and a molecular weight of 153.15 g/mol. Its IUPAC name is potassium but-2-ynedioic acid.

Molecular Properties

Compound Namepotassium but-2-ynedioic acid
PubChem CID18763942
Molecular FormulaC4H2KO4+
Molecular Weight153.15 g/mol
Exact Mass152.96
IUPAC Namepotassium but-2-ynedioic acid
SMILESO=C(O)C#CC(=O)O.[K+]
InChIInChI=1S/C4H2O4.K/c5-3(6)1-2-4(7)8;/h(H,5,6)(H,7,8);/q;+1
InChIKeyKLLYWRUTRAFSJT-UHFFFAOYSA-N
XLogP-3.84
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.15
LogP ≤ 5-3.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze potassium but-2-ynedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium but-2-ynedioic acid?
The IUPAC name of potassium but-2-ynedioic acid (CID 18763942) is potassium but-2-ynedioic acid.
What is the SMILES notation for potassium but-2-ynedioic acid?
The canonical SMILES for potassium but-2-ynedioic acid is O=C(O)C#CC(=O)O.[K+].
What is the InChIKey of potassium but-2-ynedioic acid?
The InChIKey is KLLYWRUTRAFSJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O4.K/c5-3(6)1-2-4(7)8;/h(H,5,6)(H,7,8);/q;+1.
What are the key properties of potassium but-2-ynedioic acid?
potassium but-2-ynedioic acid has a molecular weight of 153.15 g/mol, XLogP of -3.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium but-2-ynedioic acid is sourced from PubChem (CID 18763942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).