C13H2O2S — CID 155655332
13-sulfanyltrideca-2,4,6,8,10,12-hexaynoic acid (PubChem CID 155655332) has the molecular formula C13H2O2S and a molecular weight of 222.22 g/mol. Its IUPAC name is 13-sulfanyltrideca-2,4,6,8,10,12-hexaynoic acid.
| Compound Name | 13-sulfanyltrideca-2,4,6,8,10,12-hexaynoic acid |
|---|---|
| PubChem CID | 155655332 |
| Molecular Formula | C13H2O2S |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | 13-sulfanyltrideca-2,4,6,8,10,12-hexaynoic acid |
| SMILES | O=C(O)C#CC#CC#CC#CC#CC#CS |
| InChI | InChI=1S/C13H2O2S/c14-13(15)11-9-7-5-3-1-2-4-6-8-10-12-16/h16H,(H,14,15) |
| InChIKey | LKGQXULGVMGCII-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|