5-trimethylsilylpenta-2,4-diynoic acid

C8H10O2Si — CID 100996998

IUPAC5-trimethylsilylpenta-2,4-diynoic acid
SMILESC[Si](C)(C)C#CC#CC(=O)O
InChIInChI=1S/C8H10O2Si/c1-11(2,3)7-5-4-6-8(9)10/h1-3H3,(H,9,10)
InChIKeyNQJBYEIFUVGHQZ-UHFFFAOYSA-N
MW166.25 g/mol
LogP0.96
Rot. Bonds

About 5-trimethylsilylpenta-2,4-diynoic acid

5-trimethylsilylpenta-2,4-diynoic acid (PubChem CID 100996998) has the molecular formula C8H10O2Si and a molecular weight of 166.25 g/mol. Its IUPAC name is 5-trimethylsilylpenta-2,4-diynoic acid.

Molecular Properties

Compound Name5-trimethylsilylpenta-2,4-diynoic acid
PubChem CID100996998
Molecular FormulaC8H10O2Si
Molecular Weight166.25 g/mol
Exact Mass166.05
IUPAC Name5-trimethylsilylpenta-2,4-diynoic acid
SMILESC[Si](C)(C)C#CC#CC(=O)O
InChIInChI=1S/C8H10O2Si/c1-11(2,3)7-5-4-6-8(9)10/h1-3H3,(H,9,10)
InChIKeyNQJBYEIFUVGHQZ-UHFFFAOYSA-N
XLogP0.96
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.25
LogP ≤ 50.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 5-trimethylsilylpenta-2,4-diynoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-trimethylsilylpenta-2,4-diynoic acid?
The IUPAC name of 5-trimethylsilylpenta-2,4-diynoic acid (CID 100996998) is 5-trimethylsilylpenta-2,4-diynoic acid.
What is the SMILES notation for 5-trimethylsilylpenta-2,4-diynoic acid?
The canonical SMILES for 5-trimethylsilylpenta-2,4-diynoic acid is C[Si](C)(C)C#CC#CC(=O)O.
What is the InChIKey of 5-trimethylsilylpenta-2,4-diynoic acid?
The InChIKey is NQJBYEIFUVGHQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2Si/c1-11(2,3)7-5-4-6-8(9)10/h1-3H3,(H,9,10).
What are the key properties of 5-trimethylsilylpenta-2,4-diynoic acid?
5-trimethylsilylpenta-2,4-diynoic acid has a molecular weight of 166.25 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-trimethylsilylpenta-2,4-diynoic acid is sourced from PubChem (CID 100996998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).