About 4-oxopent-2-ynoic acid
4-oxopent-2-ynoic acid (PubChem CID 57311770) has the molecular formula C5H4O3
and a molecular weight of 112.08 g/mol. Its IUPAC name is 4-oxopent-2-ynoic acid.
Molecular Properties
| Compound Name | 4-oxopent-2-ynoic acid |
| PubChem CID | 57311770 |
| Molecular Formula | C5H4O3 |
| Molecular Weight | 112.08 g/mol |
| Exact Mass | 112.02 |
| IUPAC Name | 4-oxopent-2-ynoic acid |
| SMILES | CC(=O)C#CC(=O)O |
| InChI | InChI=1S/C5H4O3/c1-4(6)2-3-5(7)8/h1H3,(H,7,8) |
| InChIKey | OYVCPHJJFPNOTH-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.08 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-oxopent-2-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopent-2-ynoic acid?
The IUPAC name of 4-oxopent-2-ynoic acid (CID 57311770) is 4-oxopent-2-ynoic acid.
What is the SMILES notation for 4-oxopent-2-ynoic acid?
The canonical SMILES for 4-oxopent-2-ynoic acid is CC(=O)C#CC(=O)O.
What is the InChIKey of 4-oxopent-2-ynoic acid?
The InChIKey is OYVCPHJJFPNOTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O3/c1-4(6)2-3-5(7)8/h1H3,(H,7,8).
What are the key properties of 4-oxopent-2-ynoic acid?
4-oxopent-2-ynoic acid has a molecular weight of 112.08 g/mol, XLogP of -0.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopent-2-ynoic acid is sourced from PubChem (CID 57311770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).