About hex-3-yne-2,5-dione
hex-3-yne-2,5-dione (PubChem CID 11412356) has the molecular formula C6H6O2
and a molecular weight of 110.11 g/mol. Its IUPAC name is hex-3-yne-2,5-dione.
Molecular Properties
| Compound Name | hex-3-yne-2,5-dione |
| PubChem CID | 11412356 |
| Molecular Formula | C6H6O2 |
| Molecular Weight | 110.11 g/mol |
| Exact Mass | 110.04 |
| IUPAC Name | hex-3-yne-2,5-dione |
| SMILES | CC(=O)C#CC(C)=O |
| InChI | InChI=1S/C6H6O2/c1-5(7)3-4-6(2)8/h1-2H3 |
| InChIKey | RNSUHNFHYWLYBN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.11 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hex-3-yne-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-3-yne-2,5-dione?
The IUPAC name of hex-3-yne-2,5-dione (CID 11412356) is hex-3-yne-2,5-dione.
What is the SMILES notation for hex-3-yne-2,5-dione?
The canonical SMILES for hex-3-yne-2,5-dione is CC(=O)C#CC(C)=O.
What is the InChIKey of hex-3-yne-2,5-dione?
The InChIKey is RNSUHNFHYWLYBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2/c1-5(7)3-4-6(2)8/h1-2H3.
What are the key properties of hex-3-yne-2,5-dione?
hex-3-yne-2,5-dione has a molecular weight of 110.11 g/mol, XLogP of 0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hex-3-yne-2,5-dione is sourced from PubChem (CID 11412356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).