C22H14O4 — CID 118147499
4-[2,4,5-tris(3-oxobut-1-ynyl)phenyl]but-3-yn-2-one (PubChem CID 118147499) has the molecular formula C22H14O4 and a molecular weight of 342.35 g/mol. Its IUPAC name is 4-[2,4,5-tris(3-oxobut-1-ynyl)phenyl]but-3-yn-2-one.
| Compound Name | 4-[2,4,5-tris(3-oxobut-1-ynyl)phenyl]but-3-yn-2-one |
|---|---|
| PubChem CID | 118147499 |
| Molecular Formula | C22H14O4 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-[2,4,5-tris(3-oxobut-1-ynyl)phenyl]but-3-yn-2-one |
| SMILES | CC(=O)C#Cc1cc(C#CC(C)=O)c(C#CC(C)=O)cc1C#CC(C)=O |
| InChI | InChI=1S/C22H14O4/c1-15(23)5-9-19-13-21(11-7-17(3)25)22(12-8-18(4)26)14-20(19)10-6-16(2)24/h13-14H,1-4H3 |
| InChIKey | PELPBNZIRRIXQO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|