About 4-oxopent-2-ynyl 2-oxopropanoate
4-oxopent-2-ynyl 2-oxopropanoate (PubChem CID 170672415) has the molecular formula C8H8O4
and a molecular weight of 168.15 g/mol. Its IUPAC name is 4-oxopent-2-ynyl 2-oxopropanoate.
Molecular Properties
| Compound Name | 4-oxopent-2-ynyl 2-oxopropanoate |
| PubChem CID | 170672415 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 4-oxopent-2-ynyl 2-oxopropanoate |
| SMILES | CC(=O)C#CCOC(=O)C(C)=O |
| InChI | InChI=1S/C8H8O4/c1-6(9)4-3-5-12-8(11)7(2)10/h5H2,1-2H3 |
| InChIKey | SCFJMDASRQXRKS-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-oxopent-2-ynyl 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopent-2-ynyl 2-oxopropanoate?
The IUPAC name of 4-oxopent-2-ynyl 2-oxopropanoate (CID 170672415) is 4-oxopent-2-ynyl 2-oxopropanoate.
What is the SMILES notation for 4-oxopent-2-ynyl 2-oxopropanoate?
The canonical SMILES for 4-oxopent-2-ynyl 2-oxopropanoate is CC(=O)C#CCOC(=O)C(C)=O.
What is the InChIKey of 4-oxopent-2-ynyl 2-oxopropanoate?
The InChIKey is SCFJMDASRQXRKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4/c1-6(9)4-3-5-12-8(11)7(2)10/h5H2,1-2H3.
What are the key properties of 4-oxopent-2-ynyl 2-oxopropanoate?
4-oxopent-2-ynyl 2-oxopropanoate has a molecular weight of 168.15 g/mol, XLogP of -0.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopent-2-ynyl 2-oxopropanoate is sourced from PubChem (CID 170672415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).