About 3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate
3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate (PubChem CID 139567728) has the molecular formula C7H8FNO3
and a molecular weight of 173.14 g/mol. Its IUPAC name is 3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate.
Molecular Properties
| Compound Name | 3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate |
| PubChem CID | 139567728 |
| Molecular Formula | C7H8FNO3 |
| Molecular Weight | 173.14 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate |
| SMILES | CN(C)C(=O)C(=O)OCC#CF |
| InChI | InChI=1S/C7H8FNO3/c1-9(2)6(10)7(11)12-5-3-4-8/h5H2,1-2H3 |
| InChIKey | BRRSNSCFDIYTOS-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.14 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate?
The IUPAC name of 3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate (CID 139567728) is 3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate.
What is the SMILES notation for 3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate?
The canonical SMILES for 3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate is CN(C)C(=O)C(=O)OCC#CF.
What is the InChIKey of 3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate?
The InChIKey is BRRSNSCFDIYTOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FNO3/c1-9(2)6(10)7(11)12-5-3-4-8/h5H2,1-2H3.
What are the key properties of 3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate?
3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate has a molecular weight of 173.14 g/mol, XLogP of -0.45, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoroprop-2-ynyl 2-(dimethylamino)-2-oxoacetate is sourced from PubChem (CID 139567728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).