About 2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide
2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide (PubChem CID 89462885) has the molecular formula C5H6FNO2
and a molecular weight of 131.11 g/mol. Its IUPAC name is 2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide.
Molecular Properties
| Compound Name | 2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide |
| PubChem CID | 89462885 |
| Molecular Formula | C5H6FNO2 |
| Molecular Weight | 131.11 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | 2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide |
| SMILES | CN(C)C(=O)C(F)=C=O |
| InChI | InChI=1S/C5H6FNO2/c1-7(2)5(9)4(6)3-8/h1-2H3 |
| InChIKey | UMHGGGZUCZNNRQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.11 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide?
The IUPAC name of 2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide (CID 89462885) is 2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide.
What is the SMILES notation for 2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide?
The canonical SMILES for 2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide is CN(C)C(=O)C(F)=C=O.
What is the InChIKey of 2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide?
The InChIKey is UMHGGGZUCZNNRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6FNO2/c1-7(2)5(9)4(6)3-8/h1-2H3.
What are the key properties of 2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide?
2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide has a molecular weight of 131.11 g/mol, XLogP of -0.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N,N-dimethyl-3-oxoprop-2-enamide is sourced from PubChem (CID 89462885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).