C6H16N4O2 — CID 158796669
1,1,3,3-tetramethylurea;urea (PubChem CID 158796669) has the molecular formula C6H16N4O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is 1,1,3,3-tetramethylurea;urea.
| Compound Name | 1,1,3,3-tetramethylurea;urea |
|---|---|
| PubChem CID | 158796669 |
| Molecular Formula | C6H16N4O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1,1,3,3-tetramethylurea;urea |
| SMILES | CN(C)C(=O)N(C)C.NC(N)=O |
| InChI | InChI=1S/C5H12N2O.CH4N2O/c1-6(2)5(8)7(3)4;2-1(3)4/h1-4H3;(H4,2,3,4) |
| InChIKey | ISYFPPWORVLQAD-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |