About dimethylcarbamic acid;ethane
dimethylcarbamic acid;ethane (PubChem CID 143338074) has the molecular formula C7H19NO2
and a molecular weight of 149.23 g/mol. Its IUPAC name is dimethylcarbamic acid;ethane.
Molecular Properties
| Compound Name | dimethylcarbamic acid;ethane |
| PubChem CID | 143338074 |
| Molecular Formula | C7H19NO2 |
| Molecular Weight | 149.23 g/mol |
| Exact Mass | 149.14 |
| IUPAC Name | dimethylcarbamic acid;ethane |
| SMILES | CC.CC.CN(C)C(=O)O |
| InChI | InChI=1S/C3H7NO2.2C2H6/c1-4(2)3(5)6;2*1-2/h1-2H3,(H,5,6);2*1-2H3 |
| InChIKey | CINMYLQMMZKFLP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dimethylcarbamic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylcarbamic acid;ethane?
The IUPAC name of dimethylcarbamic acid;ethane (CID 143338074) is dimethylcarbamic acid;ethane.
What is the SMILES notation for dimethylcarbamic acid;ethane?
The canonical SMILES for dimethylcarbamic acid;ethane is CC.CC.CN(C)C(=O)O.
What is the InChIKey of dimethylcarbamic acid;ethane?
The InChIKey is CINMYLQMMZKFLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.2C2H6/c1-4(2)3(5)6;2*1-2/h1-2H3,(H,5,6);2*1-2H3.
What are the key properties of dimethylcarbamic acid;ethane?
dimethylcarbamic acid;ethane has a molecular weight of 149.23 g/mol, XLogP of 2.28, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylcarbamic acid;ethane is sourced from PubChem (CID 143338074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).