About dimethoxysilane;bis(dimethylcarbamic acid)
dimethoxysilane;bis(dimethylcarbamic acid) (PubChem CID 173419025) has the molecular formula C8H22N2O6Si
and a molecular weight of 270.36 g/mol. Its IUPAC name is dimethoxysilane;bis(dimethylcarbamic acid).
Molecular Properties
| Compound Name | dimethoxysilane;bis(dimethylcarbamic acid) |
| PubChem CID | 173419025 |
| Molecular Formula | C8H22N2O6Si |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | dimethoxysilane;bis(dimethylcarbamic acid) |
| SMILES | CN(C)C(=O)O.CN(C)C(=O)O.CO[SiH2]OC |
| InChI | InChI=1S/2C3H7NO2.C2H8O2Si/c2*1-4(2)3(5)6;1-3-5-4-2/h2*1-2H3,(H,5,6);5H2,1-2H3 |
| InChIKey | JSELJQWMHBTOKX-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxysilane;bis(dimethylcarbamic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxysilane;bis(dimethylcarbamic acid)?
The IUPAC name of dimethoxysilane;bis(dimethylcarbamic acid) (CID 173419025) is dimethoxysilane;bis(dimethylcarbamic acid).
What is the SMILES notation for dimethoxysilane;bis(dimethylcarbamic acid)?
The canonical SMILES for dimethoxysilane;bis(dimethylcarbamic acid) is CN(C)C(=O)O.CN(C)C(=O)O.CO[SiH2]OC.
What is the InChIKey of dimethoxysilane;bis(dimethylcarbamic acid)?
The InChIKey is JSELJQWMHBTOKX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H7NO2.C2H8O2Si/c2*1-4(2)3(5)6;1-3-5-4-2/h2*1-2H3,(H,5,6);5H2,1-2H3.
What are the key properties of dimethoxysilane;bis(dimethylcarbamic acid)?
dimethoxysilane;bis(dimethylcarbamic acid) has a molecular weight of 270.36 g/mol, XLogP of -0.27, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxysilane;bis(dimethylcarbamic acid) is sourced from PubChem (CID 173419025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).