About methoxysilyl N-methoxy-N-methylcarbamate
methoxysilyl N-methoxy-N-methylcarbamate (PubChem CID 173427291) has the molecular formula C4H11NO4Si
and a molecular weight of 165.22 g/mol. Its IUPAC name is methoxysilyl N-methoxy-N-methylcarbamate.
Molecular Properties
| Compound Name | methoxysilyl N-methoxy-N-methylcarbamate |
| PubChem CID | 173427291 |
| Molecular Formula | C4H11NO4Si |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | methoxysilyl N-methoxy-N-methylcarbamate |
| SMILES | CO[SiH2]OC(=O)N(C)OC |
| InChI | InChI=1S/C4H11NO4Si/c1-5(7-2)4(6)9-10-8-3/h10H2,1-3H3 |
| InChIKey | UDSZZYAJSAJIEL-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methoxysilyl N-methoxy-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxysilyl N-methoxy-N-methylcarbamate?
The IUPAC name of methoxysilyl N-methoxy-N-methylcarbamate (CID 173427291) is methoxysilyl N-methoxy-N-methylcarbamate.
What is the SMILES notation for methoxysilyl N-methoxy-N-methylcarbamate?
The canonical SMILES for methoxysilyl N-methoxy-N-methylcarbamate is CO[SiH2]OC(=O)N(C)OC.
What is the InChIKey of methoxysilyl N-methoxy-N-methylcarbamate?
The InChIKey is UDSZZYAJSAJIEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO4Si/c1-5(7-2)4(6)9-10-8-3/h10H2,1-3H3.
What are the key properties of methoxysilyl N-methoxy-N-methylcarbamate?
methoxysilyl N-methoxy-N-methylcarbamate has a molecular weight of 165.22 g/mol, XLogP of -0.74, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methoxysilyl N-methoxy-N-methylcarbamate is sourced from PubChem (CID 173427291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).