About 2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide
2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide (PubChem CID 121234956) has the molecular formula C6H12F2N2O3S
and a molecular weight of 230.24 g/mol. Its IUPAC name is 2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide |
| PubChem CID | 121234956 |
| Molecular Formula | C6H12F2N2O3S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C(F)(F)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C6H12F2N2O3S/c1-9(2)5(11)6(7,8)14(12,13)10(3)4/h1-4H3 |
| InChIKey | WLHIHKNNIGGGND-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide?
The IUPAC name of 2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide (CID 121234956) is 2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide.
What is the SMILES notation for 2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide?
The canonical SMILES for 2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide is CN(C)C(=O)C(F)(F)S(=O)(=O)N(C)C.
What is the InChIKey of 2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide?
The InChIKey is WLHIHKNNIGGGND-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F2N2O3S/c1-9(2)5(11)6(7,8)14(12,13)10(3)4/h1-4H3.
What are the key properties of 2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide?
2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide has a molecular weight of 230.24 g/mol, XLogP of -0.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylsulfamoyl)-2,2-difluoro-N,N-dimethylacetamide is sourced from PubChem (CID 121234956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).