N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid

C4H14F3NO7SSi — CID 174409588

IUPACN,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid
SMILESCN(C)C.O=S(=O)(O)C(F)(F)F.O[Si](O)(O)O
InChIInChI=1S/C3H9N.CHF3O3S.H4O4Si/c1-4(2)3;2-1(3,4)8(5,6)7;1-5(2,3)4/h1-3H3;(H,5,6,7);1-4H
InChIKeyYNRRNABBFSSPGM-UHFFFAOYSA-N
MW305.30 g/mol
LogP-2.04
Rot. Bonds

About N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid

N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid (PubChem CID 174409588) has the molecular formula C4H14F3NO7SSi and a molecular weight of 305.30 g/mol. Its IUPAC name is N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid.

Molecular Properties

Compound NameN,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid
PubChem CID174409588
Molecular FormulaC4H14F3NO7SSi
Molecular Weight305.30 g/mol
Exact Mass305.02
IUPAC NameN,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid
SMILESCN(C)C.O=S(=O)(O)C(F)(F)F.O[Si](O)(O)O
InChIInChI=1S/C3H9N.CHF3O3S.H4O4Si/c1-4(2)3;2-1(3,4)8(5,6)7;1-5(2,3)4/h1-3H3;(H,5,6,7);1-4H
InChIKeyYNRRNABBFSSPGM-UHFFFAOYSA-N
XLogP-2.04
TPSA138.53 Ų
H-Bond Donors5
H-Bond Acceptors7
Rotatable Bonds
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.30
LogP ≤ 5-2.04
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}

Analyze N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid?
The IUPAC name of N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid (CID 174409588) is N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid.
What is the SMILES notation for N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid?
The canonical SMILES for N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid is CN(C)C.O=S(=O)(O)C(F)(F)F.O[Si](O)(O)O.
What is the InChIKey of N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid?
The InChIKey is YNRRNABBFSSPGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.CHF3O3S.H4O4Si/c1-4(2)3;2-1(3,4)8(5,6)7;1-5(2,3)4/h1-3H3;(H,5,6,7);1-4H.
What are the key properties of N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid?
N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid has a molecular weight of 305.30 g/mol, XLogP of -2.04, 0 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid is sourced from PubChem (CID 174409588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).