C4H14F3NO7SSi — CID 174409588
N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid (PubChem CID 174409588) has the molecular formula C4H14F3NO7SSi and a molecular weight of 305.30 g/mol. Its IUPAC name is N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid.
| Compound Name | N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 174409588 |
| Molecular Formula | C4H14F3NO7SSi |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | N,N-dimethylmethanamine;silicic acid;trifluoromethanesulfonic acid |
| SMILES | CN(C)C.O=S(=O)(O)C(F)(F)F.O[Si](O)(O)O |
| InChI | InChI=1S/C3H9N.CHF3O3S.H4O4Si/c1-4(2)3;2-1(3,4)8(5,6)7;1-5(2,3)4/h1-3H3;(H,5,6,7);1-4H |
| InChIKey | YNRRNABBFSSPGM-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|