About chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid)
chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid) (PubChem CID 162109712) has the molecular formula C5H11ClF6O6S2Si
and a molecular weight of 408.80 g/mol. Its IUPAC name is chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid).
Molecular Properties
| Compound Name | chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid) |
| PubChem CID | 162109712 |
| Molecular Formula | C5H11ClF6O6S2Si |
| Molecular Weight | 408.80 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid) |
| SMILES | C[Si](C)(C)Cl.O=S(=O)(O)C(F)(F)F.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C3H9ClSi.2CHF3O3S/c1-5(2,3)4;2*2-1(3,4)8(5,6)7/h1-3H3;2*(H,5,6,7) |
| InChIKey | ZFZHROMOTHFSRF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid)?
The IUPAC name of chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid) (CID 162109712) is chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid).
What is the SMILES notation for chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid)?
The canonical SMILES for chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid) is C[Si](C)(C)Cl.O=S(=O)(O)C(F)(F)F.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid)?
The InChIKey is ZFZHROMOTHFSRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9ClSi.2CHF3O3S/c1-5(2,3)4;2*2-1(3,4)8(5,6)7/h1-3H3;2*(H,5,6,7).
What are the key properties of chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid)?
chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid) has a molecular weight of 408.80 g/mol, XLogP of 2.85, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(trimethyl)silane;bis(trifluoromethanesulfonic acid) is sourced from PubChem (CID 162109712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).