C3H7F2NO5S2 — CID 59833728
1,1-difluoro-N,N-dimethyl-1-(trioxidanylsulfanyl)methanesulfonamide (PubChem CID 59833728) has the molecular formula C3H7F2NO5S2 and a molecular weight of 239.22 g/mol. Its IUPAC name is 1,1-difluoro-N,N-dimethyl-1-(trioxidanylsulfanyl)methanesulfonamide.
| Compound Name | 1,1-difluoro-N,N-dimethyl-1-(trioxidanylsulfanyl)methanesulfonamide |
|---|---|
| PubChem CID | 59833728 |
| Molecular Formula | C3H7F2NO5S2 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | 1,1-difluoro-N,N-dimethyl-1-(trioxidanylsulfanyl)methanesulfonamide |
| SMILES | CN(C)S(=O)(=O)C(F)(F)SOOO |
| InChI | InChI=1S/C3H7F2NO5S2/c1-6(2)13(8,9)3(4,5)12-11-10-7/h7H,1-2H3 |
| InChIKey | GWTSXMAYAGUCFV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|