C2F6LiNO7S3 — CID 153347503
lithium N,N-bis(trifluoromethylsulfonyl)sulfamate (PubChem CID 153347503) has the molecular formula C2F6LiNO7S3 and a molecular weight of 367.15 g/mol. Its IUPAC name is lithium N,N-bis(trifluoromethylsulfonyl)sulfamate.
| Compound Name | lithium N,N-bis(trifluoromethylsulfonyl)sulfamate |
|---|---|
| PubChem CID | 153347503 |
| Molecular Formula | C2F6LiNO7S3 |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 366.89 |
| IUPAC Name | lithium N,N-bis(trifluoromethylsulfonyl)sulfamate |
| SMILES | O=S(=O)([O-])N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.[Li+] |
| InChI | InChI=1S/C2HF6NO7S3.Li/c3-1(4,5)17(10,11)9(19(14,15)16)18(12,13)2(6,7)8;/h(H,14,15,16);/q;+1/p-1 |
| InChIKey | FDCPVUUXMKCQQG-UHFFFAOYSA-M |
| XLogP | -3.55 |
| TPSA | 128.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|